About N-[(3,5-dimethoxycyclohexa-2,5-dien-1-yl)methyl]ethanamine
N-[(3,5-dimethoxycyclohexa-2,5-dien-1-yl)methyl]ethanamine (PubChem CID 86128733) has the molecular formula C11H19NO2
and a molecular weight of 197.28 g/mol. Its IUPAC name is N-[(3,5-dimethoxycyclohexa-2,5-dien-1-yl)methyl]ethanamine.
Molecular Properties
| Compound Name | N-[(3,5-dimethoxycyclohexa-2,5-dien-1-yl)methyl]ethanamine |
| PubChem CID | 86128733 |
| Molecular Formula | C11H19NO2 |
| Molecular Weight | 197.28 g/mol |
| Exact Mass | 197.14 |
| IUPAC Name | N-[(3,5-dimethoxycyclohexa-2,5-dien-1-yl)methyl]ethanamine |
| SMILES | CCNCC1C=C(OC)CC(OC)=C1 |
| InChI | InChI=1S/C11H19NO2/c1-4-12-8-9-5-10(13-2)7-11(6-9)14-3/h5-6,9,12H,4,7-8H2,1-3H3 |
| InChIKey | NEIHNOGKZJJTBY-UHFFFAOYSA-N |
| XLogP | 1.68 |
| TPSA | 30.49 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 197.28 |
| LogP ≤ 5 | 1.68 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze N-[(3,5-dimethoxycyclohexa-2,5-dien-1-yl)methyl]ethanamine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-[(3,5-dimethoxycyclohexa-2,5-dien-1-yl)methyl]ethanamine?
The IUPAC name of N-[(3,5-dimethoxycyclohexa-2,5-dien-1-yl)methyl]ethanamine (CID 86128733) is N-[(3,5-dimethoxycyclohexa-2,5-dien-1-yl)methyl]ethanamine.
What is the SMILES notation for N-[(3,5-dimethoxycyclohexa-2,5-dien-1-yl)methyl]ethanamine?
The canonical SMILES for N-[(3,5-dimethoxycyclohexa-2,5-dien-1-yl)methyl]ethanamine is CCNCC1C=C(OC)CC(OC)=C1.
What is the InChIKey of N-[(3,5-dimethoxycyclohexa-2,5-dien-1-yl)methyl]ethanamine?
The InChIKey is NEIHNOGKZJJTBY-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H19NO2/c1-4-12-8-9-5-10(13-2)7-11(6-9)14-3/h5-6,9,12H,4,7-8H2,1-3H3.
What are the key properties of N-[(3,5-dimethoxycyclohexa-2,5-dien-1-yl)methyl]ethanamine?
N-[(3,5-dimethoxycyclohexa-2,5-dien-1-yl)methyl]ethanamine has a molecular weight of 197.28 g/mol, XLogP of 1.68, 5 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for N-[(3,5-dimethoxycyclohexa-2,5-dien-1-yl)methyl]ethanamine is sourced from PubChem (CID 86128733), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).