About 1H-imidazo[4,5-b]pyridine-2-carbothioamide
1H-imidazo[4,5-b]pyridine-2-carbothioamide (PubChem CID 86130577) has the molecular formula C7H6N4S
and a molecular weight of 178.22 g/mol. Its IUPAC name is 1H-imidazo[4,5-b]pyridine-2-carbothioamide.
Molecular Properties
| Compound Name | 1H-imidazo[4,5-b]pyridine-2-carbothioamide |
| PubChem CID | 86130577 |
| Molecular Formula | C7H6N4S |
| Molecular Weight | 178.22 g/mol |
| Exact Mass | 178.03 |
| IUPAC Name | 1H-imidazo[4,5-b]pyridine-2-carbothioamide |
| SMILES | NC(=S)c1nc2ncccc2[nH]1 |
| InChI | InChI=1S/C7H6N4S/c8-5(12)7-10-4-2-1-3-9-6(4)11-7/h1-3H,(H2,8,12)(H,9,10,11) |
| InChIKey | SLZXXPCEHIXJFX-UHFFFAOYSA-N |
| XLogP | 0.59 |
| TPSA | 67.59 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 12 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 178.22 |
| LogP ≤ 5 | 0.59 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|
Analyze 1H-imidazo[4,5-b]pyridine-2-carbothioamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1H-imidazo[4,5-b]pyridine-2-carbothioamide?
The IUPAC name of 1H-imidazo[4,5-b]pyridine-2-carbothioamide (CID 86130577) is 1H-imidazo[4,5-b]pyridine-2-carbothioamide.
What is the SMILES notation for 1H-imidazo[4,5-b]pyridine-2-carbothioamide?
The canonical SMILES for 1H-imidazo[4,5-b]pyridine-2-carbothioamide is NC(=S)c1nc2ncccc2[nH]1.
What is the InChIKey of 1H-imidazo[4,5-b]pyridine-2-carbothioamide?
The InChIKey is SLZXXPCEHIXJFX-UHFFFAOYSA-N. The full InChI is InChI=1S/C7H6N4S/c8-5(12)7-10-4-2-1-3-9-6(4)11-7/h1-3H,(H2,8,12)(H,9,10,11).
What are the key properties of 1H-imidazo[4,5-b]pyridine-2-carbothioamide?
1H-imidazo[4,5-b]pyridine-2-carbothioamide has a molecular weight of 178.22 g/mol, XLogP of 0.59, 1 rotatable bonds, 2 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 1H-imidazo[4,5-b]pyridine-2-carbothioamide is sourced from PubChem (CID 86130577), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).