C13H13F5O2 — CID 86130863
hexyl 2,3,4,5,6-pentafluorobenzoate (PubChem CID 86130863) has the molecular formula C13H13F5O2 and a molecular weight of 296.24 g/mol. Its IUPAC name is hexyl 2,3,4,5,6-pentafluorobenzoate.
| Compound Name | hexyl 2,3,4,5,6-pentafluorobenzoate |
|---|---|
| PubChem CID | 86130863 |
| Molecular Formula | C13H13F5O2 |
| Molecular Weight | 296.24 g/mol |
| Exact Mass | 296.08 |
| IUPAC Name | hexyl 2,3,4,5,6-pentafluorobenzoate |
| SMILES | CCCCCCOC(=O)c1c(F)c(F)c(F)c(F)c1F |
| InChI | InChI=1S/C13H13F5O2/c1-2-3-4-5-6-20-13(19)7-8(14)10(16)12(18)11(17)9(7)15/h2-6H2,1H3 |
| InChIKey | WVNPCCPQMDSFOU-UHFFFAOYSA-N |
| XLogP | 4.12 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 296.24 |
| LogP ≤ 5 | 4.12 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'}, {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'} |
|---|