C7H7F4NO2 — CID 86132032
1-(2,2,6,6-tetrafluoromorpholin-4-yl)prop-2-en-1-one (PubChem CID 86132032) has the molecular formula C7H7F4NO2 and a molecular weight of 213.13 g/mol. Its IUPAC name is 1-(2,2,6,6-tetrafluoromorpholin-4-yl)prop-2-en-1-one.
| Compound Name | 1-(2,2,6,6-tetrafluoromorpholin-4-yl)prop-2-en-1-one |
|---|---|
| PubChem CID | 86132032 |
| Molecular Formula | C7H7F4NO2 |
| Molecular Weight | 213.13 g/mol |
| Exact Mass | 213.04 |
| IUPAC Name | 1-(2,2,6,6-tetrafluoromorpholin-4-yl)prop-2-en-1-one |
| SMILES | C=CC(=O)N1CC(F)(F)OC(F)(F)C1 |
| InChI | InChI=1S/C7H7F4NO2/c1-2-5(13)12-3-6(8,9)14-7(10,11)4-12/h2H,1,3-4H2 |
| InChIKey | OMOYOKFWVDUAGL-UHFFFAOYSA-N |
| XLogP | 1.22 |
| TPSA | 29.54 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 213.13 |
| LogP ≤ 5 | 1.22 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|