C16H14BrNO3 — CID 86133135
2-bromo-3-(3,3-dimethyl-2,6-dioxocyclohexanecarbonyl)benzonitrile (PubChem CID 86133135) has the molecular formula C16H14BrNO3 and a molecular weight of 348.20 g/mol. Its IUPAC name is 2-bromo-3-(3,3-dimethyl-2,6-dioxocyclohexanecarbonyl)benzonitrile.
| Compound Name | 2-bromo-3-(3,3-dimethyl-2,6-dioxocyclohexanecarbonyl)benzonitrile |
|---|---|
| PubChem CID | 86133135 |
| Molecular Formula | C16H14BrNO3 |
| Molecular Weight | 348.20 g/mol |
| Exact Mass | 347.02 |
| IUPAC Name | 2-bromo-3-(3,3-dimethyl-2,6-dioxocyclohexanecarbonyl)benzonitrile |
| SMILES | CC1(C)CCC(=O)C(C(=O)c2cccc(C#N)c2Br)C1=O |
| InChI | InChI=1S/C16H14BrNO3/c1-16(2)7-6-11(19)12(15(16)21)14(20)10-5-3-4-9(8-18)13(10)17/h3-5,12H,6-7H2,1-2H3 |
| InChIKey | ONYQEXDQVRFDNU-UHFFFAOYSA-N |
| XLogP | 3.08 |
| TPSA | 75.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 348.20 |
| LogP ≤ 5 | 3.08 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|