C18H25NO6S — CID 8613426
ethyl 4-(2-methylpropyl)-2-[[2-(4-oxopentanoyloxy)acetyl]amino]thiophene-3-carboxylate (PubChem CID 8613426) has the molecular formula C18H25NO6S and a molecular weight of 383.47 g/mol. Its IUPAC name is ethyl 4-(2-methylpropyl)-2-[[2-(4-oxopentanoyloxy)acetyl]amino]thiophene-3-carboxylate.
| Compound Name | ethyl 4-(2-methylpropyl)-2-[[2-(4-oxopentanoyloxy)acetyl]amino]thiophene-3-carboxylate |
|---|---|
| PubChem CID | 8613426 |
| Molecular Formula | C18H25NO6S |
| Molecular Weight | 383.47 g/mol |
| Exact Mass | 383.14 |
| IUPAC Name | ethyl 4-(2-methylpropyl)-2-[[2-(4-oxopentanoyloxy)acetyl]amino]thiophene-3-carboxylate |
| SMILES | CCOC(=O)c1c(CC(C)C)csc1NC(=O)COC(=O)CCC(C)=O |
| InChI | InChI=1S/C18H25NO6S/c1-5-24-18(23)16-13(8-11(2)3)10-26-17(16)19-14(21)9-25-15(22)7-6-12(4)20/h10-11H,5-9H2,1-4H3,(H,19,21) |
| InChIKey | QMQOLGIPRPCSNR-UHFFFAOYSA-N |
| XLogP | 2.97 |
| TPSA | 98.77 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 383.47 |
| LogP ≤ 5 | 2.97 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |