C7H5Cl3S — CID 86135617
1,3,5-trichloro-2-methylsulfanylbenzene (PubChem CID 86135617) has the molecular formula C7H5Cl3S and a molecular weight of 227.54 g/mol. Its IUPAC name is 1,3,5-trichloro-2-methylsulfanylbenzene.
| Compound Name | 1,3,5-trichloro-2-methylsulfanylbenzene |
|---|---|
| PubChem CID | 86135617 |
| Molecular Formula | C7H5Cl3S |
| Molecular Weight | 227.54 g/mol |
| Exact Mass | 225.92 |
| IUPAC Name | 1,3,5-trichloro-2-methylsulfanylbenzene |
| SMILES | CSc1c(Cl)cc(Cl)cc1Cl |
| InChI | InChI=1S/C7H5Cl3S/c1-11-7-5(9)2-4(8)3-6(7)10/h2-3H,1H3 |
| InChIKey | VIPLIJZPGBVUQA-UHFFFAOYSA-N |
| XLogP | 4.37 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 11 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 227.54 |
| LogP ≤ 5 | 4.37 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |