C19H40N4O2 — CID 86136288
N,N'-bis(7-aminoheptyl)pentanediamide (PubChem CID 86136288) has the molecular formula C19H40N4O2 and a molecular weight of 356.56 g/mol. Its IUPAC name is N,N'-bis(7-aminoheptyl)pentanediamide.
| Compound Name | N,N'-bis(7-aminoheptyl)pentanediamide |
|---|---|
| PubChem CID | 86136288 |
| Molecular Formula | C19H40N4O2 |
| Molecular Weight | 356.56 g/mol |
| Exact Mass | 356.32 |
| IUPAC Name | N,N'-bis(7-aminoheptyl)pentanediamide |
| SMILES | NCCCCCCCNC(=O)CCCC(=O)NCCCCCCCN |
| InChI | InChI=1S/C19H40N4O2/c20-14-7-3-1-5-9-16-22-18(24)12-11-13-19(25)23-17-10-6-2-4-8-15-21/h1-17,20-21H2,(H,22,24)(H,23,25) |
| InChIKey | FZRPTGGPFQCZTR-UHFFFAOYSA-N |
| XLogP | 2.21 |
| TPSA | 110.24 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 18 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 356.56 |
| LogP ≤ 5 | 2.21 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|