About tert-butyl-(3,3-dimethylbut-1-ynyl)-dimethylsilane
tert-butyl-(3,3-dimethylbut-1-ynyl)-dimethylsilane (PubChem CID 86138061) has the molecular formula C12H24Si
and a molecular weight of 196.41 g/mol. Its IUPAC name is tert-butyl-(3,3-dimethylbut-1-ynyl)-dimethylsilane.
Molecular Properties
| Compound Name | tert-butyl-(3,3-dimethylbut-1-ynyl)-dimethylsilane |
| PubChem CID | 86138061 |
| Molecular Formula | C12H24Si |
| Molecular Weight | 196.41 g/mol |
| Exact Mass | 196.16 |
| IUPAC Name | tert-butyl-(3,3-dimethylbut-1-ynyl)-dimethylsilane |
| SMILES | CC(C)(C)C#C[Si](C)(C)C(C)(C)C |
| InChI | InChI=1S/C12H24Si/c1-11(2,3)9-10-13(7,8)12(4,5)6/h1-8H3 |
| InChIKey | KLTPGALCGCQIOM-UHFFFAOYSA-N |
| XLogP | 4.08 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 196.41 |
| LogP ≤ 5 | 4.08 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|
Analyze tert-butyl-(3,3-dimethylbut-1-ynyl)-dimethylsilane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of tert-butyl-(3,3-dimethylbut-1-ynyl)-dimethylsilane?
The IUPAC name of tert-butyl-(3,3-dimethylbut-1-ynyl)-dimethylsilane (CID 86138061) is tert-butyl-(3,3-dimethylbut-1-ynyl)-dimethylsilane.
What is the SMILES notation for tert-butyl-(3,3-dimethylbut-1-ynyl)-dimethylsilane?
The canonical SMILES for tert-butyl-(3,3-dimethylbut-1-ynyl)-dimethylsilane is CC(C)(C)C#C[Si](C)(C)C(C)(C)C.
What is the InChIKey of tert-butyl-(3,3-dimethylbut-1-ynyl)-dimethylsilane?
The InChIKey is KLTPGALCGCQIOM-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H24Si/c1-11(2,3)9-10-13(7,8)12(4,5)6/h1-8H3.
What are the key properties of tert-butyl-(3,3-dimethylbut-1-ynyl)-dimethylsilane?
tert-butyl-(3,3-dimethylbut-1-ynyl)-dimethylsilane has a molecular weight of 196.41 g/mol, XLogP of 4.08, 0 rotatable bonds, 0 hydrogen bond donors, and 0 hydrogen bond acceptors.
Where does this data come from?
All data for tert-butyl-(3,3-dimethylbut-1-ynyl)-dimethylsilane is sourced from PubChem (CID 86138061), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).