About 2-ethoxyethyl 2-sulfanylpropanoate
2-ethoxyethyl 2-sulfanylpropanoate (PubChem CID 86140679) has the molecular formula C7H14O3S
and a molecular weight of 178.25 g/mol. Its IUPAC name is 2-ethoxyethyl 2-sulfanylpropanoate.
Molecular Properties
| Compound Name | 2-ethoxyethyl 2-sulfanylpropanoate |
| PubChem CID | 86140679 |
| Molecular Formula | C7H14O3S |
| Molecular Weight | 178.25 g/mol |
| Exact Mass | 178.07 |
| IUPAC Name | 2-ethoxyethyl 2-sulfanylpropanoate |
| SMILES | CCOCCOC(=O)C(C)S |
| InChI | InChI=1S/C7H14O3S/c1-3-9-4-5-10-7(8)6(2)11/h6,11H,3-5H2,1-2H3 |
| InChIKey | ZRXKZCSTAMRCGB-UHFFFAOYSA-N |
| XLogP | 0.88 |
| TPSA | 35.53 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 11 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 178.25 |
| LogP ≤ 5 | 0.88 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|
Analyze 2-ethoxyethyl 2-sulfanylpropanoate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-ethoxyethyl 2-sulfanylpropanoate?
The IUPAC name of 2-ethoxyethyl 2-sulfanylpropanoate (CID 86140679) is 2-ethoxyethyl 2-sulfanylpropanoate.
What is the SMILES notation for 2-ethoxyethyl 2-sulfanylpropanoate?
The canonical SMILES for 2-ethoxyethyl 2-sulfanylpropanoate is CCOCCOC(=O)C(C)S.
What is the InChIKey of 2-ethoxyethyl 2-sulfanylpropanoate?
The InChIKey is ZRXKZCSTAMRCGB-UHFFFAOYSA-N. The full InChI is InChI=1S/C7H14O3S/c1-3-9-4-5-10-7(8)6(2)11/h6,11H,3-5H2,1-2H3.
What are the key properties of 2-ethoxyethyl 2-sulfanylpropanoate?
2-ethoxyethyl 2-sulfanylpropanoate has a molecular weight of 178.25 g/mol, XLogP of 0.88, 5 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 2-ethoxyethyl 2-sulfanylpropanoate is sourced from PubChem (CID 86140679), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).