C11H32O5Si5 — CID 86143517
2-ethyl-2,4,4,6,6,8,8,10,10-nonamethyl-1,3,5,7,9,2,4,6,8,10-pentaoxapentasilecane (PubChem CID 86143517) has the molecular formula C11H32O5Si5 and a molecular weight of 384.80 g/mol. Its IUPAC name is 2-ethyl-2,4,4,6,6,8,8,10,10-nonamethyl-1,3,5,7,9,2,4,6,8,10-pentaoxapentasilecane.
| Compound Name | 2-ethyl-2,4,4,6,6,8,8,10,10-nonamethyl-1,3,5,7,9,2,4,6,8,10-pentaoxapentasilecane |
|---|---|
| PubChem CID | 86143517 |
| Molecular Formula | C11H32O5Si5 |
| Molecular Weight | 384.80 g/mol |
| Exact Mass | 384.11 |
| IUPAC Name | 2-ethyl-2,4,4,6,6,8,8,10,10-nonamethyl-1,3,5,7,9,2,4,6,8,10-pentaoxapentasilecane |
| SMILES | CC[Si]1(C)O[Si](C)(C)O[Si](C)(C)O[Si](C)(C)O[Si](C)(C)O1 |
| InChI | InChI=1S/C11H32O5Si5/c1-11-21(10)15-19(6,7)13-17(2,3)12-18(4,5)14-20(8,9)16-21/h11H2,1-10H3 |
| InChIKey | RFMVJNNWHVUGFV-UHFFFAOYSA-N |
| XLogP | 3.98 |
| TPSA | 46.15 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 384.80 |
| LogP ≤ 5 | 3.98 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|