About bicyclo[1.1.0]butane-2,4-dione
bicyclo[1.1.0]butane-2,4-dione (PubChem CID 86144370) has the molecular formula C4H2O2
and a molecular weight of 82.06 g/mol. Its IUPAC name is bicyclo[1.1.0]butane-2,4-dione.
Molecular Properties
| Compound Name | bicyclo[1.1.0]butane-2,4-dione |
| PubChem CID | 86144370 |
| Molecular Formula | C4H2O2 |
| Molecular Weight | 82.06 g/mol |
| Exact Mass | 82.01 |
| IUPAC Name | bicyclo[1.1.0]butane-2,4-dione |
| SMILES | O=C1C2C(=O)C12 |
| InChI | InChI=1S/C4H2O2/c5-3-1-2(3)4(1)6/h1-2H |
| InChIKey | CQMRRHGHCNMNGP-UHFFFAOYSA-N |
| XLogP | -0.62 |
| TPSA | 34.14 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 6 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 82.06 |
| LogP ≤ 5 | -0.62 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|
Analyze bicyclo[1.1.0]butane-2,4-dione with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of bicyclo[1.1.0]butane-2,4-dione?
The IUPAC name of bicyclo[1.1.0]butane-2,4-dione (CID 86144370) is bicyclo[1.1.0]butane-2,4-dione.
What is the SMILES notation for bicyclo[1.1.0]butane-2,4-dione?
The canonical SMILES for bicyclo[1.1.0]butane-2,4-dione is O=C1C2C(=O)C12.
What is the InChIKey of bicyclo[1.1.0]butane-2,4-dione?
The InChIKey is CQMRRHGHCNMNGP-UHFFFAOYSA-N. The full InChI is InChI=1S/C4H2O2/c5-3-1-2(3)4(1)6/h1-2H.
What are the key properties of bicyclo[1.1.0]butane-2,4-dione?
bicyclo[1.1.0]butane-2,4-dione has a molecular weight of 82.06 g/mol, XLogP of -0.62, 0 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for bicyclo[1.1.0]butane-2,4-dione is sourced from PubChem (CID 86144370), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).