C10H10O3 — CID 86150963
7-methyl-6,7-dihydrofuro[3,2-g][1,3]benzodioxole (PubChem CID 86150963) has the molecular formula C10H10O3 and a molecular weight of 178.19 g/mol. Its IUPAC name is 7-methyl-6,7-dihydrofuro[3,2-g][1,3]benzodioxole.
| Compound Name | 7-methyl-6,7-dihydrofuro[3,2-g][1,3]benzodioxole |
|---|---|
| PubChem CID | 86150963 |
| Molecular Formula | C10H10O3 |
| Molecular Weight | 178.19 g/mol |
| Exact Mass | 178.06 |
| IUPAC Name | 7-methyl-6,7-dihydrofuro[3,2-g][1,3]benzodioxole |
| SMILES | CC1Cc2ccc3c(c2O1)OCO3 |
| InChI | InChI=1S/C10H10O3/c1-6-4-7-2-3-8-10(9(7)13-6)12-5-11-8/h2-3,6H,4-5H2,1H3 |
| InChIKey | QBRRBEBZLAWDDF-UHFFFAOYSA-N |
| XLogP | 1.74 |
| TPSA | 27.69 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 178.19 |
| LogP ≤ 5 | 1.74 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |