About 6-ethoxy-1-ethyl-2,2,4-trimethylquinoline
6-ethoxy-1-ethyl-2,2,4-trimethylquinoline (PubChem CID 86152390) has the molecular formula C16H23NO
and a molecular weight of 245.37 g/mol. Its IUPAC name is 6-ethoxy-1-ethyl-2,2,4-trimethylquinoline.
Molecular Properties
| Compound Name | 6-ethoxy-1-ethyl-2,2,4-trimethylquinoline |
| PubChem CID | 86152390 |
| Molecular Formula | C16H23NO |
| Molecular Weight | 245.37 g/mol |
| Exact Mass | 245.18 |
| IUPAC Name | 6-ethoxy-1-ethyl-2,2,4-trimethylquinoline |
| SMILES | CCOc1ccc2c(c1)C(C)=CC(C)(C)N2CC |
| InChI | InChI=1S/C16H23NO/c1-6-17-15-9-8-13(18-7-2)10-14(15)12(3)11-16(17,4)5/h8-11H,6-7H2,1-5H3 |
| InChIKey | YABRVLJEMCDWQI-UHFFFAOYSA-N |
| XLogP | 4.11 |
| TPSA | 12.47 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 245.37 |
| LogP ≤ 5 | 4.11 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'anil_di_alk_C(246)', 'substructure': 'N/A'} |
|---|
Analyze 6-ethoxy-1-ethyl-2,2,4-trimethylquinoline with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 6-ethoxy-1-ethyl-2,2,4-trimethylquinoline?
The IUPAC name of 6-ethoxy-1-ethyl-2,2,4-trimethylquinoline (CID 86152390) is 6-ethoxy-1-ethyl-2,2,4-trimethylquinoline.
What is the SMILES notation for 6-ethoxy-1-ethyl-2,2,4-trimethylquinoline?
The canonical SMILES for 6-ethoxy-1-ethyl-2,2,4-trimethylquinoline is CCOc1ccc2c(c1)C(C)=CC(C)(C)N2CC.
What is the InChIKey of 6-ethoxy-1-ethyl-2,2,4-trimethylquinoline?
The InChIKey is YABRVLJEMCDWQI-UHFFFAOYSA-N. The full InChI is InChI=1S/C16H23NO/c1-6-17-15-9-8-13(18-7-2)10-14(15)12(3)11-16(17,4)5/h8-11H,6-7H2,1-5H3.
What are the key properties of 6-ethoxy-1-ethyl-2,2,4-trimethylquinoline?
6-ethoxy-1-ethyl-2,2,4-trimethylquinoline has a molecular weight of 245.37 g/mol, XLogP of 4.11, 3 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 6-ethoxy-1-ethyl-2,2,4-trimethylquinoline is sourced from PubChem (CID 86152390), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).