C17H23N2P — CID 86152590
N'-diphenylphosphanyl-N,N,N'-trimethylethane-1,2-diamine (PubChem CID 86152590) has the molecular formula C17H23N2P and a molecular weight of 286.36 g/mol. Its IUPAC name is N'-diphenylphosphanyl-N,N,N'-trimethylethane-1,2-diamine.
| Compound Name | N'-diphenylphosphanyl-N,N,N'-trimethylethane-1,2-diamine |
|---|---|
| PubChem CID | 86152590 |
| Molecular Formula | C17H23N2P |
| Molecular Weight | 286.36 g/mol |
| Exact Mass | 286.16 |
| IUPAC Name | N'-diphenylphosphanyl-N,N,N'-trimethylethane-1,2-diamine |
| SMILES | CN(C)CCN(C)P(c1ccccc1)c1ccccc1 |
| InChI | InChI=1S/C17H23N2P/c1-18(2)14-15-19(3)20(16-10-6-4-7-11-16)17-12-8-5-9-13-17/h4-13H,14-15H2,1-3H3 |
| InChIKey | TUHMABSUHPBSAB-UHFFFAOYSA-N |
| XLogP | 2.53 |
| TPSA | 6.48 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 286.36 |
| LogP ≤ 5 | 2.53 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|