C12H14F9I — CID 86153409
1,1,1,2,2,3,3,4,4-nonafluoro-6-iodododec-5-ene (PubChem CID 86153409) has the molecular formula C12H14F9I and a molecular weight of 456.13 g/mol. Its IUPAC name is 1,1,1,2,2,3,3,4,4-nonafluoro-6-iodododec-5-ene.
| Compound Name | 1,1,1,2,2,3,3,4,4-nonafluoro-6-iodododec-5-ene |
|---|---|
| PubChem CID | 86153409 |
| Molecular Formula | C12H14F9I |
| Molecular Weight | 456.13 g/mol |
| Exact Mass | 456.00 |
| IUPAC Name | 1,1,1,2,2,3,3,4,4-nonafluoro-6-iodododec-5-ene |
| SMILES | CCCCCCC(I)=CC(F)(F)C(F)(F)C(F)(F)C(F)(F)F |
| InChI | InChI=1S/C12H14F9I/c1-2-3-4-5-6-8(22)7-9(13,14)10(15,16)11(17,18)12(19,20)21/h7H,2-6H2,1H3 |
| InChIKey | HLLNKYADPLDRRE-UHFFFAOYSA-N |
| XLogP | 6.74 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 8 |
| Heavy Atoms | 22 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 456.13 |
| LogP ≤ 5 | 6.74 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|