C6H5F7O2 — CID 86154818
2-(1,1,2,2,3,3,3-heptafluoropropyl)-1,3-dioxolane (PubChem CID 86154818) has the molecular formula C6H5F7O2 and a molecular weight of 242.09 g/mol. Its IUPAC name is 2-(1,1,2,2,3,3,3-heptafluoropropyl)-1,3-dioxolane.
| Compound Name | 2-(1,1,2,2,3,3,3-heptafluoropropyl)-1,3-dioxolane |
|---|---|
| PubChem CID | 86154818 |
| Molecular Formula | C6H5F7O2 |
| Molecular Weight | 242.09 g/mol |
| Exact Mass | 242.02 |
| IUPAC Name | 2-(1,1,2,2,3,3,3-heptafluoropropyl)-1,3-dioxolane |
| SMILES | FC(F)(F)C(F)(F)C(F)(F)C1OCCO1 |
| InChI | InChI=1S/C6H5F7O2/c7-4(8,3-14-1-2-15-3)5(9,10)6(11,12)13/h3H,1-2H2 |
| InChIKey | MTUYJNFDNUPNFQ-UHFFFAOYSA-N |
| XLogP | 2.19 |
| TPSA | 18.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 242.09 |
| LogP ≤ 5 | 2.19 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|