About N-methyl-N-(4-phenyl-1,3-thiazol-2-yl)furan-2-carboxamide
N-methyl-N-(4-phenyl-1,3-thiazol-2-yl)furan-2-carboxamide (PubChem CID 861583) has the molecular formula C15H12N2O2S
and a molecular weight of 284.34 g/mol. Its IUPAC name is N-methyl-N-(4-phenyl-1,3-thiazol-2-yl)furan-2-carboxamide.
Molecular Properties
| Compound Name | N-methyl-N-(4-phenyl-1,3-thiazol-2-yl)furan-2-carboxamide |
| PubChem CID | 861583 |
| Molecular Formula | C15H12N2O2S |
| Molecular Weight | 284.34 g/mol |
| Exact Mass | 284.06 |
| IUPAC Name | N-methyl-N-(4-phenyl-1,3-thiazol-2-yl)furan-2-carboxamide |
| SMILES | CN(C(=O)c1ccco1)c1nc(-c2ccccc2)cs1 |
| InChI | InChI=1S/C15H12N2O2S/c1-17(14(18)13-8-5-9-19-13)15-16-12(10-20-15)11-6-3-2-4-7-11/h2-10H,1H3 |
| InChIKey | ZTWZBRODJLTDEC-UHFFFAOYSA-N |
| XLogP | 3.68 |
| TPSA | 46.34 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 284.34 |
| LogP ≤ 5 | 3.68 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze N-methyl-N-(4-phenyl-1,3-thiazol-2-yl)furan-2-carboxamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-methyl-N-(4-phenyl-1,3-thiazol-2-yl)furan-2-carboxamide?
The IUPAC name of N-methyl-N-(4-phenyl-1,3-thiazol-2-yl)furan-2-carboxamide (CID 861583) is N-methyl-N-(4-phenyl-1,3-thiazol-2-yl)furan-2-carboxamide.
What is the SMILES notation for N-methyl-N-(4-phenyl-1,3-thiazol-2-yl)furan-2-carboxamide?
The canonical SMILES for N-methyl-N-(4-phenyl-1,3-thiazol-2-yl)furan-2-carboxamide is CN(C(=O)c1ccco1)c1nc(-c2ccccc2)cs1.
What is the InChIKey of N-methyl-N-(4-phenyl-1,3-thiazol-2-yl)furan-2-carboxamide?
The InChIKey is ZTWZBRODJLTDEC-UHFFFAOYSA-N. The full InChI is InChI=1S/C15H12N2O2S/c1-17(14(18)13-8-5-9-19-13)15-16-12(10-20-15)11-6-3-2-4-7-11/h2-10H,1H3.
What are the key properties of N-methyl-N-(4-phenyl-1,3-thiazol-2-yl)furan-2-carboxamide?
N-methyl-N-(4-phenyl-1,3-thiazol-2-yl)furan-2-carboxamide has a molecular weight of 284.34 g/mol, XLogP of 3.68, 3 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for N-methyl-N-(4-phenyl-1,3-thiazol-2-yl)furan-2-carboxamide is sourced from PubChem (CID 861583), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).