About 1-octa-2,7-dienylazepan-2-one
1-octa-2,7-dienylazepan-2-one (PubChem CID 86158665) has the molecular formula C14H23NO
and a molecular weight of 221.34 g/mol. Its IUPAC name is 1-octa-2,7-dienylazepan-2-one.
Molecular Properties
| Compound Name | 1-octa-2,7-dienylazepan-2-one |
| PubChem CID | 86158665 |
| Molecular Formula | C14H23NO |
| Molecular Weight | 221.34 g/mol |
| Exact Mass | 221.18 |
| IUPAC Name | 1-octa-2,7-dienylazepan-2-one |
| SMILES | C=CCCCC=CCN1CCCCCC1=O |
| InChI | InChI=1S/C14H23NO/c1-2-3-4-5-6-9-12-15-13-10-7-8-11-14(15)16/h2,6,9H,1,3-5,7-8,10-13H2 |
| InChIKey | VKOOVRLUWHFIDA-UHFFFAOYSA-N |
| XLogP | 3.30 |
| TPSA | 20.31 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 16 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 221.34 |
| LogP ≤ 5 | 3.30 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|
Analyze 1-octa-2,7-dienylazepan-2-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-octa-2,7-dienylazepan-2-one?
The IUPAC name of 1-octa-2,7-dienylazepan-2-one (CID 86158665) is 1-octa-2,7-dienylazepan-2-one.
What is the SMILES notation for 1-octa-2,7-dienylazepan-2-one?
The canonical SMILES for 1-octa-2,7-dienylazepan-2-one is C=CCCCC=CCN1CCCCCC1=O.
What is the InChIKey of 1-octa-2,7-dienylazepan-2-one?
The InChIKey is VKOOVRLUWHFIDA-UHFFFAOYSA-N. The full InChI is InChI=1S/C14H23NO/c1-2-3-4-5-6-9-12-15-13-10-7-8-11-14(15)16/h2,6,9H,1,3-5,7-8,10-13H2.
What are the key properties of 1-octa-2,7-dienylazepan-2-one?
1-octa-2,7-dienylazepan-2-one has a molecular weight of 221.34 g/mol, XLogP of 3.30, 6 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 1-octa-2,7-dienylazepan-2-one is sourced from PubChem (CID 86158665), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).