About [(2,2,2-trifluoro-1-phenylethylidene)amino] 4-hydroxybenzenesulfonate
[(2,2,2-trifluoro-1-phenylethylidene)amino] 4-hydroxybenzenesulfonate (PubChem CID 86161480) has the molecular formula C14H10F3NO4S
and a molecular weight of 345.30 g/mol. Its IUPAC name is [(2,2,2-trifluoro-1-phenylethylidene)amino] 4-hydroxybenzenesulfonate.
Molecular Properties
| Compound Name | [(2,2,2-trifluoro-1-phenylethylidene)amino] 4-hydroxybenzenesulfonate |
| PubChem CID | 86161480 |
| Molecular Formula | C14H10F3NO4S |
| Molecular Weight | 345.30 g/mol |
| Exact Mass | 345.03 |
| IUPAC Name | [(2,2,2-trifluoro-1-phenylethylidene)amino] 4-hydroxybenzenesulfonate |
| SMILES | O=S(=O)(ON=C(c1ccccc1)C(F)(F)F)c1ccc(O)cc1 |
| InChI | InChI=1S/C14H10F3NO4S/c15-14(16,17)13(10-4-2-1-3-5-10)18-22-23(20,21)12-8-6-11(19)7-9-12/h1-9,19H |
| InChIKey | CIAONNAYIJKPNL-UHFFFAOYSA-N |
| XLogP | 3.06 |
| TPSA | 75.96 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 345.30 |
| LogP ≤ 5 | 3.06 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|
Analyze [(2,2,2-trifluoro-1-phenylethylidene)amino] 4-hydroxybenzenesulfonate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of [(2,2,2-trifluoro-1-phenylethylidene)amino] 4-hydroxybenzenesulfonate?
The IUPAC name of [(2,2,2-trifluoro-1-phenylethylidene)amino] 4-hydroxybenzenesulfonate (CID 86161480) is [(2,2,2-trifluoro-1-phenylethylidene)amino] 4-hydroxybenzenesulfonate.
What is the SMILES notation for [(2,2,2-trifluoro-1-phenylethylidene)amino] 4-hydroxybenzenesulfonate?
The canonical SMILES for [(2,2,2-trifluoro-1-phenylethylidene)amino] 4-hydroxybenzenesulfonate is O=S(=O)(ON=C(c1ccccc1)C(F)(F)F)c1ccc(O)cc1.
What is the InChIKey of [(2,2,2-trifluoro-1-phenylethylidene)amino] 4-hydroxybenzenesulfonate?
The InChIKey is CIAONNAYIJKPNL-UHFFFAOYSA-N. The full InChI is InChI=1S/C14H10F3NO4S/c15-14(16,17)13(10-4-2-1-3-5-10)18-22-23(20,21)12-8-6-11(19)7-9-12/h1-9,19H.
What are the key properties of [(2,2,2-trifluoro-1-phenylethylidene)amino] 4-hydroxybenzenesulfonate?
[(2,2,2-trifluoro-1-phenylethylidene)amino] 4-hydroxybenzenesulfonate has a molecular weight of 345.30 g/mol, XLogP of 3.06, 4 rotatable bonds, 1 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for [(2,2,2-trifluoro-1-phenylethylidene)amino] 4-hydroxybenzenesulfonate is sourced from PubChem (CID 86161480), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).