C32H16S8 — CID 86162098
2-[2,3,4-tris(1,3-benzodithiol-2-ylidene)cyclobutylidene]-1,3-benzodithiole (PubChem CID 86162098) has the molecular formula C32H16S8 and a molecular weight of 657.02 g/mol. Its IUPAC name is 2-[2,3,4-tris(1,3-benzodithiol-2-ylidene)cyclobutylidene]-1,3-benzodithiole.
| Compound Name | 2-[2,3,4-tris(1,3-benzodithiol-2-ylidene)cyclobutylidene]-1,3-benzodithiole |
|---|---|
| PubChem CID | 86162098 |
| Molecular Formula | C32H16S8 |
| Molecular Weight | 657.02 g/mol |
| Exact Mass | 655.90 |
| IUPAC Name | 2-[2,3,4-tris(1,3-benzodithiol-2-ylidene)cyclobutylidene]-1,3-benzodithiole |
| SMILES | c1ccc2c(c1)SC(=C1C(=C3Sc4ccccc4S3)C(=C3Sc4ccccc4S3)C1=C1Sc3ccccc3S1)S2 |
| InChI | InChI=1S/C32H16S8/c1-2-10-18-17(9-1)33-29(34-18)25-26(30-35-19-11-3-4-12-20(19)36-30)28(32-39-23-15-7-8-16-24(23)40-32)27(25)31-37-21-13-5-6-14-22(21)38-31/h1-16H |
| InChIKey | ZACCPNIUBPDJFB-UHFFFAOYSA-N |
| XLogP | 12.44 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 657.02 |
| LogP ≤ 5 | 12.44 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |