C8H24SiSn2 — CID 86162142
trimethyl(1,1,2,2,2-pentamethyldistannyl)silane (PubChem CID 86162142) has the molecular formula C8H24SiSn2 and a molecular weight of 385.79 g/mol.
| Compound Name | trimethyl(1,1,2,2,2-pentamethyldistannyl)silane |
|---|---|
| PubChem CID | 86162142 |
| Molecular Formula | C8H24SiSn2 |
| Molecular Weight | 385.79 g/mol |
| Exact Mass | 387.97 |
| IUPAC Name | — |
| SMILES | C[Si]C.C[Sn](C)C.C[Sn](C)C |
| InChI | InChI=1S/C2H6Si.6CH3.2Sn/c1-3-2;;;;;;;;/h1-2H3;6*1H3;; |
| InChIKey | YXYRYFDUZHHTRV-UHFFFAOYSA-N |
| XLogP | 3.53 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | |
| Heavy Atoms | 11 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 385.79 |
| LogP ≤ 5 | 3.53 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|