C6H5F7O — CID 86162788
3,3,4,4,5,5,5-heptafluoro-2-methylpentanal (PubChem CID 86162788) has the molecular formula C6H5F7O and a molecular weight of 226.09 g/mol. Its IUPAC name is 3,3,4,4,5,5,5-heptafluoro-2-methylpentanal.
| Compound Name | 3,3,4,4,5,5,5-heptafluoro-2-methylpentanal |
|---|---|
| PubChem CID | 86162788 |
| Molecular Formula | C6H5F7O |
| Molecular Weight | 226.09 g/mol |
| Exact Mass | 226.02 |
| IUPAC Name | 3,3,4,4,5,5,5-heptafluoro-2-methylpentanal |
| SMILES | CC(C=O)C(F)(F)C(F)(F)C(F)(F)F |
| InChI | InChI=1S/C6H5F7O/c1-3(2-14)4(7,8)5(9,10)6(11,12)13/h2-3H,1H3 |
| InChIKey | LIVMJRVNDYMEMQ-UHFFFAOYSA-N |
| XLogP | 2.65 |
| TPSA | 17.07 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 226.09 |
| LogP ≤ 5 | 2.65 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|