About 3-imino-5,6-bis(octoxymethyl)isoindol-1-amine
3-imino-5,6-bis(octoxymethyl)isoindol-1-amine (PubChem CID 86163181) has the molecular formula C26H43N3O2
and a molecular weight of 429.65 g/mol. Its IUPAC name is 3-imino-5,6-bis(octoxymethyl)isoindol-1-amine.
Molecular Properties
| Compound Name | 3-imino-5,6-bis(octoxymethyl)isoindol-1-amine |
| PubChem CID | 86163181 |
| Molecular Formula | C26H43N3O2 |
| Molecular Weight | 429.65 g/mol |
| Exact Mass | 429.34 |
| IUPAC Name | 3-imino-5,6-bis(octoxymethyl)isoindol-1-amine |
| SMILES | [H]/N=C1\N=C(N)c2cc(COCCCCCCCC)c(COCCCCCCCC)cc21 |
| InChI | InChI=1S/C26H43N3O2/c1-3-5-7-9-11-13-15-30-19-21-17-23-24(26(28)29-25(23)27)18-22(21)20-31-16-14-12-10-8-6-4-2/h17-18H,3-16,19-20H2,1-2H3,(H3,27,28,29) |
| InChIKey | IPXVCGGLQUEWOF-UHFFFAOYSA-N |
| XLogP | 6.49 |
| TPSA | 80.69 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 18 |
| Heavy Atoms | 31 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 429.65 |
| LogP ≤ 5 | 6.49 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|
Analyze 3-imino-5,6-bis(octoxymethyl)isoindol-1-amine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-imino-5,6-bis(octoxymethyl)isoindol-1-amine?
The IUPAC name of 3-imino-5,6-bis(octoxymethyl)isoindol-1-amine (CID 86163181) is 3-imino-5,6-bis(octoxymethyl)isoindol-1-amine.
What is the SMILES notation for 3-imino-5,6-bis(octoxymethyl)isoindol-1-amine?
The canonical SMILES for 3-imino-5,6-bis(octoxymethyl)isoindol-1-amine is [H]/N=C1\N=C(N)c2cc(COCCCCCCCC)c(COCCCCCCCC)cc21.
What is the InChIKey of 3-imino-5,6-bis(octoxymethyl)isoindol-1-amine?
The InChIKey is IPXVCGGLQUEWOF-UHFFFAOYSA-N. The full InChI is InChI=1S/C26H43N3O2/c1-3-5-7-9-11-13-15-30-19-21-17-23-24(26(28)29-25(23)27)18-22(21)20-31-16-14-12-10-8-6-4-2/h17-18H,3-16,19-20H2,1-2H3,(H3,27,28,29).
What are the key properties of 3-imino-5,6-bis(octoxymethyl)isoindol-1-amine?
3-imino-5,6-bis(octoxymethyl)isoindol-1-amine has a molecular weight of 429.65 g/mol, XLogP of 6.49, 18 rotatable bonds, 2 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 3-imino-5,6-bis(octoxymethyl)isoindol-1-amine is sourced from PubChem (CID 86163181), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).