About (5-bromothiophen-2-yl)-dimethyl-trimethylsilylsilane
(5-bromothiophen-2-yl)-dimethyl-trimethylsilylsilane (PubChem CID 86164582) has the molecular formula C9H17BrSSi2
and a molecular weight of 293.38 g/mol. Its IUPAC name is (5-bromothiophen-2-yl)-dimethyl-trimethylsilylsilane.
Molecular Properties
| Compound Name | (5-bromothiophen-2-yl)-dimethyl-trimethylsilylsilane |
| PubChem CID | 86164582 |
| Molecular Formula | C9H17BrSSi2 |
| Molecular Weight | 293.38 g/mol |
| Exact Mass | 291.98 |
| IUPAC Name | (5-bromothiophen-2-yl)-dimethyl-trimethylsilylsilane |
| SMILES | C[Si](C)(C)[Si](C)(C)c1ccc(Br)s1 |
| InChI | InChI=1S/C9H17BrSSi2/c1-12(2,3)13(4,5)9-7-6-8(10)11-9/h6-7H,1-5H3 |
| InChIKey | QBMMMOJBQIXFMX-UHFFFAOYSA-N |
| XLogP | 3.84 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 293.38 |
| LogP ≤ 5 | 3.84 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|
Analyze (5-bromothiophen-2-yl)-dimethyl-trimethylsilylsilane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (5-bromothiophen-2-yl)-dimethyl-trimethylsilylsilane?
The IUPAC name of (5-bromothiophen-2-yl)-dimethyl-trimethylsilylsilane (CID 86164582) is (5-bromothiophen-2-yl)-dimethyl-trimethylsilylsilane.
What is the SMILES notation for (5-bromothiophen-2-yl)-dimethyl-trimethylsilylsilane?
The canonical SMILES for (5-bromothiophen-2-yl)-dimethyl-trimethylsilylsilane is C[Si](C)(C)[Si](C)(C)c1ccc(Br)s1.
What is the InChIKey of (5-bromothiophen-2-yl)-dimethyl-trimethylsilylsilane?
The InChIKey is QBMMMOJBQIXFMX-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H17BrSSi2/c1-12(2,3)13(4,5)9-7-6-8(10)11-9/h6-7H,1-5H3.
What are the key properties of (5-bromothiophen-2-yl)-dimethyl-trimethylsilylsilane?
(5-bromothiophen-2-yl)-dimethyl-trimethylsilylsilane has a molecular weight of 293.38 g/mol, XLogP of 3.84, 2 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for (5-bromothiophen-2-yl)-dimethyl-trimethylsilylsilane is sourced from PubChem (CID 86164582), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).