About (2,5-dioxopyrrolidin-1-yl) anthracene-9-carboxylate
(2,5-dioxopyrrolidin-1-yl) anthracene-9-carboxylate (PubChem CID 86165751) has the molecular formula C19H13NO4
and a molecular weight of 319.32 g/mol. Its IUPAC name is (2,5-dioxopyrrolidin-1-yl) anthracene-9-carboxylate.
Molecular Properties
| Compound Name | (2,5-dioxopyrrolidin-1-yl) anthracene-9-carboxylate |
| PubChem CID | 86165751 |
| Molecular Formula | C19H13NO4 |
| Molecular Weight | 319.32 g/mol |
| Exact Mass | 319.08 |
| IUPAC Name | (2,5-dioxopyrrolidin-1-yl) anthracene-9-carboxylate |
| SMILES | O=C(ON1C(=O)CCC1=O)c1c2ccccc2cc2ccccc12 |
| InChI | InChI=1S/C19H13NO4/c21-16-9-10-17(22)20(16)24-19(23)18-14-7-3-1-5-12(14)11-13-6-2-4-8-15(13)18/h1-8,11H,9-10H2 |
| InChIKey | KIHNWIWOUMNCLJ-UHFFFAOYSA-N |
| XLogP | 3.21 |
| TPSA | 63.68 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 24 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 319.32 |
| LogP ≤ 5 | 3.21 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'}, {'alert_name': 'Polycyclic_aromatic_hydrocarbon_2', 'substructure': 'N/A'} |
|---|
Analyze (2,5-dioxopyrrolidin-1-yl) anthracene-9-carboxylate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (2,5-dioxopyrrolidin-1-yl) anthracene-9-carboxylate?
The IUPAC name of (2,5-dioxopyrrolidin-1-yl) anthracene-9-carboxylate (CID 86165751) is (2,5-dioxopyrrolidin-1-yl) anthracene-9-carboxylate.
What is the SMILES notation for (2,5-dioxopyrrolidin-1-yl) anthracene-9-carboxylate?
The canonical SMILES for (2,5-dioxopyrrolidin-1-yl) anthracene-9-carboxylate is O=C(ON1C(=O)CCC1=O)c1c2ccccc2cc2ccccc12.
What is the InChIKey of (2,5-dioxopyrrolidin-1-yl) anthracene-9-carboxylate?
The InChIKey is KIHNWIWOUMNCLJ-UHFFFAOYSA-N. The full InChI is InChI=1S/C19H13NO4/c21-16-9-10-17(22)20(16)24-19(23)18-14-7-3-1-5-12(14)11-13-6-2-4-8-15(13)18/h1-8,11H,9-10H2.
What are the key properties of (2,5-dioxopyrrolidin-1-yl) anthracene-9-carboxylate?
(2,5-dioxopyrrolidin-1-yl) anthracene-9-carboxylate has a molecular weight of 319.32 g/mol, XLogP of 3.21, 2 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for (2,5-dioxopyrrolidin-1-yl) anthracene-9-carboxylate is sourced from PubChem (CID 86165751), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).