C14H22O2S — CID 86167557
1,1-dimethoxyhexan-2-ylsulfanylbenzene (PubChem CID 86167557) has the molecular formula C14H22O2S and a molecular weight of 254.39 g/mol. Its IUPAC name is 1,1-dimethoxyhexan-2-ylsulfanylbenzene.
| Compound Name | 1,1-dimethoxyhexan-2-ylsulfanylbenzene |
|---|---|
| PubChem CID | 86167557 |
| Molecular Formula | C14H22O2S |
| Molecular Weight | 254.39 g/mol |
| Exact Mass | 254.13 |
| IUPAC Name | 1,1-dimethoxyhexan-2-ylsulfanylbenzene |
| SMILES | CCCCC(Sc1ccccc1)C(OC)OC |
| InChI | InChI=1S/C14H22O2S/c1-4-5-11-13(14(15-2)16-3)17-12-9-7-6-8-10-12/h6-10,13-14H,4-5,11H2,1-3H3 |
| InChIKey | JRQAYIAMRLFTCH-UHFFFAOYSA-N |
| XLogP | 3.96 |
| TPSA | 18.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 254.39 |
| LogP ≤ 5 | 3.96 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|