C28H29N3O2 — CID 86169380
3-(4-pyrrolidin-1-yl-N-(4-pyrrolidin-1-ylphenyl)anilino)-3H-2-benzofuran-1-one (PubChem CID 86169380) has the molecular formula C28H29N3O2 and a molecular weight of 439.56 g/mol. Its IUPAC name is 3-(4-pyrrolidin-1-yl-N-(4-pyrrolidin-1-ylphenyl)anilino)-3H-2-benzofuran-1-one.
| Compound Name | 3-(4-pyrrolidin-1-yl-N-(4-pyrrolidin-1-ylphenyl)anilino)-3H-2-benzofuran-1-one |
|---|---|
| PubChem CID | 86169380 |
| Molecular Formula | C28H29N3O2 |
| Molecular Weight | 439.56 g/mol |
| Exact Mass | 439.23 |
| IUPAC Name | 3-(4-pyrrolidin-1-yl-N-(4-pyrrolidin-1-ylphenyl)anilino)-3H-2-benzofuran-1-one |
| SMILES | O=C1OC(N(c2ccc(N3CCCC3)cc2)c2ccc(N3CCCC3)cc2)c2ccccc21 |
| InChI | InChI=1S/C28H29N3O2/c32-28-26-8-2-1-7-25(26)27(33-28)31(23-13-9-21(10-14-23)29-17-3-4-18-29)24-15-11-22(12-16-24)30-19-5-6-20-30/h1-2,7-16,27H,3-6,17-20H2 |
| InChIKey | GZVSILUHWICELG-UHFFFAOYSA-N |
| XLogP | 5.89 |
| TPSA | 36.02 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 439.56 |
| LogP ≤ 5 | 5.89 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'} |
|---|