About 2-(6-bromo-3-methoxy-2,4-dimethylphenyl)-4-methoxy-3,5-dimethylaniline
2-(6-bromo-3-methoxy-2,4-dimethylphenyl)-4-methoxy-3,5-dimethylaniline (PubChem CID 86169619) has the molecular formula C18H22BrNO2
and a molecular weight of 364.28 g/mol. Its IUPAC name is 2-(6-bromo-3-methoxy-2,4-dimethylphenyl)-4-methoxy-3,5-dimethylaniline.
Molecular Properties
| Compound Name | 2-(6-bromo-3-methoxy-2,4-dimethylphenyl)-4-methoxy-3,5-dimethylaniline |
| PubChem CID | 86169619 |
| Molecular Formula | C18H22BrNO2 |
| Molecular Weight | 364.28 g/mol |
| Exact Mass | 363.08 |
| IUPAC Name | 2-(6-bromo-3-methoxy-2,4-dimethylphenyl)-4-methoxy-3,5-dimethylaniline |
| SMILES | COc1c(C)cc(N)c(-c2c(Br)cc(C)c(OC)c2C)c1C |
| InChI | InChI=1S/C18H22BrNO2/c1-9-7-13(19)15(11(3)17(9)21-5)16-12(4)18(22-6)10(2)8-14(16)20/h7-8H,20H2,1-6H3 |
| InChIKey | UROSZFJDGXBLAS-UHFFFAOYSA-N |
| XLogP | 4.95 |
| TPSA | 44.48 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 22 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 364.28 |
| LogP ≤ 5 | 4.95 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|
Analyze 2-(6-bromo-3-methoxy-2,4-dimethylphenyl)-4-methoxy-3,5-dimethylaniline with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-(6-bromo-3-methoxy-2,4-dimethylphenyl)-4-methoxy-3,5-dimethylaniline?
The IUPAC name of 2-(6-bromo-3-methoxy-2,4-dimethylphenyl)-4-methoxy-3,5-dimethylaniline (CID 86169619) is 2-(6-bromo-3-methoxy-2,4-dimethylphenyl)-4-methoxy-3,5-dimethylaniline.
What is the SMILES notation for 2-(6-bromo-3-methoxy-2,4-dimethylphenyl)-4-methoxy-3,5-dimethylaniline?
The canonical SMILES for 2-(6-bromo-3-methoxy-2,4-dimethylphenyl)-4-methoxy-3,5-dimethylaniline is COc1c(C)cc(N)c(-c2c(Br)cc(C)c(OC)c2C)c1C.
What is the InChIKey of 2-(6-bromo-3-methoxy-2,4-dimethylphenyl)-4-methoxy-3,5-dimethylaniline?
The InChIKey is UROSZFJDGXBLAS-UHFFFAOYSA-N. The full InChI is InChI=1S/C18H22BrNO2/c1-9-7-13(19)15(11(3)17(9)21-5)16-12(4)18(22-6)10(2)8-14(16)20/h7-8H,20H2,1-6H3.
What are the key properties of 2-(6-bromo-3-methoxy-2,4-dimethylphenyl)-4-methoxy-3,5-dimethylaniline?
2-(6-bromo-3-methoxy-2,4-dimethylphenyl)-4-methoxy-3,5-dimethylaniline has a molecular weight of 364.28 g/mol, XLogP of 4.95, 3 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 2-(6-bromo-3-methoxy-2,4-dimethylphenyl)-4-methoxy-3,5-dimethylaniline is sourced from PubChem (CID 86169619), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).