C10H8O — CID 86169630
tricyclo[5.2.1.02,6]deca-2(6),4,8-trien-3-one (PubChem CID 86169630) has the molecular formula C10H8O and a molecular weight of 144.17 g/mol. Its IUPAC name is tricyclo[5.2.1.02,6]deca-2(6),4,8-trien-3-one.
| Compound Name | tricyclo[5.2.1.02,6]deca-2(6),4,8-trien-3-one |
|---|---|
| PubChem CID | 86169630 |
| Molecular Formula | C10H8O |
| Molecular Weight | 144.17 g/mol |
| Exact Mass | 144.06 |
| IUPAC Name | tricyclo[5.2.1.02,6]deca-2(6),4,8-trien-3-one |
| SMILES | O=C1C=CC2=C1C1C=CC2C1 |
| InChI | InChI=1S/C10H8O/c11-9-4-3-8-6-1-2-7(5-6)10(8)9/h1-4,6-7H,5H2 |
| InChIKey | HCJMQUMTPKOHMX-UHFFFAOYSA-N |
| XLogP | 1.63 |
| TPSA | 17.07 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | |
| Heavy Atoms | 11 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 144.17 |
| LogP ≤ 5 | 1.63 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|