C17H17NO3 — CID 86172085
(4,6-dimethoxy-3-phenyl-1H-indol-7-yl)methanol (PubChem CID 86172085) has the molecular formula C17H17NO3 and a molecular weight of 283.33 g/mol. Its IUPAC name is (4,6-dimethoxy-3-phenyl-1H-indol-7-yl)methanol.
| Compound Name | (4,6-dimethoxy-3-phenyl-1H-indol-7-yl)methanol |
|---|---|
| PubChem CID | 86172085 |
| Molecular Formula | C17H17NO3 |
| Molecular Weight | 283.33 g/mol |
| Exact Mass | 283.12 |
| IUPAC Name | (4,6-dimethoxy-3-phenyl-1H-indol-7-yl)methanol |
| SMILES | COc1cc(OC)c2c(-c3ccccc3)c[nH]c2c1CO |
| InChI | InChI=1S/C17H17NO3/c1-20-14-8-15(21-2)16-12(11-6-4-3-5-7-11)9-18-17(16)13(14)10-19/h3-9,18-19H,10H2,1-2H3 |
| InChIKey | PBISZTHKCNUZHZ-UHFFFAOYSA-N |
| XLogP | 3.34 |
| TPSA | 54.48 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 283.33 |
| LogP ≤ 5 | 3.34 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |