About 5-butyldodeca-3,4-dien-6-yne
5-butyldodeca-3,4-dien-6-yne (PubChem CID 86172770) has the molecular formula C16H26
and a molecular weight of 218.38 g/mol. Its IUPAC name is 5-butyldodeca-3,4-dien-6-yne.
Molecular Properties
| Compound Name | 5-butyldodeca-3,4-dien-6-yne |
| PubChem CID | 86172770 |
| Molecular Formula | C16H26 |
| Molecular Weight | 218.38 g/mol |
| Exact Mass | 218.20 |
| IUPAC Name | 5-butyldodeca-3,4-dien-6-yne |
| SMILES | CCC=C=C(C#CCCCCC)CCCC |
| InChI | InChI=1S/C16H26/c1-4-7-10-11-12-15-16(13-8-5-2)14-9-6-3/h8H,4-7,9-11,14H2,1-3H3 |
| InChIKey | CPDKIBVIKULMDN-UHFFFAOYSA-N |
| XLogP | 5.25 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 7 |
| Heavy Atoms | 16 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 218.38 |
| LogP ≤ 5 | 5.25 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|
Analyze 5-butyldodeca-3,4-dien-6-yne with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 5-butyldodeca-3,4-dien-6-yne?
The IUPAC name of 5-butyldodeca-3,4-dien-6-yne (CID 86172770) is 5-butyldodeca-3,4-dien-6-yne.
What is the SMILES notation for 5-butyldodeca-3,4-dien-6-yne?
The canonical SMILES for 5-butyldodeca-3,4-dien-6-yne is CCC=C=C(C#CCCCCC)CCCC.
What is the InChIKey of 5-butyldodeca-3,4-dien-6-yne?
The InChIKey is CPDKIBVIKULMDN-UHFFFAOYSA-N. The full InChI is InChI=1S/C16H26/c1-4-7-10-11-12-15-16(13-8-5-2)14-9-6-3/h8H,4-7,9-11,14H2,1-3H3.
What are the key properties of 5-butyldodeca-3,4-dien-6-yne?
5-butyldodeca-3,4-dien-6-yne has a molecular weight of 218.38 g/mol, XLogP of 5.25, 7 rotatable bonds, 0 hydrogen bond donors, and 0 hydrogen bond acceptors.
Where does this data come from?
All data for 5-butyldodeca-3,4-dien-6-yne is sourced from PubChem (CID 86172770), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).