About 2-(2,6-dimethylphenyl)selanyl-1,3-dimethylbenzene
2-(2,6-dimethylphenyl)selanyl-1,3-dimethylbenzene (PubChem CID 86173294) has the molecular formula C16H18Se
and a molecular weight of 289.28 g/mol. Its IUPAC name is 2-(2,6-dimethylphenyl)selanyl-1,3-dimethylbenzene.
Molecular Properties
| Compound Name | 2-(2,6-dimethylphenyl)selanyl-1,3-dimethylbenzene |
| PubChem CID | 86173294 |
| Molecular Formula | C16H18Se |
| Molecular Weight | 289.28 g/mol |
| Exact Mass | 290.06 |
| IUPAC Name | 2-(2,6-dimethylphenyl)selanyl-1,3-dimethylbenzene |
| SMILES | Cc1cccc(C)c1[Se]c1c(C)cccc1C |
| InChI | InChI=1S/C16H18Se/c1-11-7-5-8-12(2)15(11)17-16-13(3)9-6-10-14(16)4/h5-10H,1-4H3 |
| InChIKey | ZZMXSMFABDJHJG-UHFFFAOYSA-N |
| XLogP | 2.58 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 2 |
| Heavy Atoms | 17 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 289.28 |
| LogP ≤ 5 | 2.58 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|
Analyze 2-(2,6-dimethylphenyl)selanyl-1,3-dimethylbenzene with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-(2,6-dimethylphenyl)selanyl-1,3-dimethylbenzene?
The IUPAC name of 2-(2,6-dimethylphenyl)selanyl-1,3-dimethylbenzene (CID 86173294) is 2-(2,6-dimethylphenyl)selanyl-1,3-dimethylbenzene.
What is the SMILES notation for 2-(2,6-dimethylphenyl)selanyl-1,3-dimethylbenzene?
The canonical SMILES for 2-(2,6-dimethylphenyl)selanyl-1,3-dimethylbenzene is Cc1cccc(C)c1[Se]c1c(C)cccc1C.
What is the InChIKey of 2-(2,6-dimethylphenyl)selanyl-1,3-dimethylbenzene?
The InChIKey is ZZMXSMFABDJHJG-UHFFFAOYSA-N. The full InChI is InChI=1S/C16H18Se/c1-11-7-5-8-12(2)15(11)17-16-13(3)9-6-10-14(16)4/h5-10H,1-4H3.
What are the key properties of 2-(2,6-dimethylphenyl)selanyl-1,3-dimethylbenzene?
2-(2,6-dimethylphenyl)selanyl-1,3-dimethylbenzene has a molecular weight of 289.28 g/mol, XLogP of 2.58, 2 rotatable bonds, 0 hydrogen bond donors, and 0 hydrogen bond acceptors.
Where does this data come from?
All data for 2-(2,6-dimethylphenyl)selanyl-1,3-dimethylbenzene is sourced from PubChem (CID 86173294), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).