About CID 86173784
CID 86173784 (PubChem CID 86173784) has the molecular formula C12H14N2P2Sb2
and a molecular weight of 491.73 g/mol.
Molecular Properties
| Compound Name | CID 86173784 |
| PubChem CID | 86173784 |
| Molecular Formula | C12H14N2P2Sb2 |
| Molecular Weight | 491.73 g/mol |
| Exact Mass | 489.87 |
| IUPAC Name | — |
| SMILES | Pc1ccccc1N[Sb].Pc1ccccc1N[Sb] |
| InChI | InChI=1S/2C6H7NP.2Sb/c2*7-5-3-1-2-4-6(5)8;;/h2*1-4,7H,8H2;;/q2*-1;2*+1 |
| InChIKey | PMSUECLQKYBMEW-UHFFFAOYSA-N |
| XLogP | 1.36 |
| TPSA | 24.06 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 18 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 491.73 |
| LogP ≤ 5 | 1.36 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|
Analyze CID 86173784 with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of CID 86173784?
The IUPAC name of CID 86173784 (CID 86173784) is not available.
What is the SMILES notation for CID 86173784?
The canonical SMILES for CID 86173784 is Pc1ccccc1N[Sb].Pc1ccccc1N[Sb].
What is the InChIKey of CID 86173784?
The InChIKey is PMSUECLQKYBMEW-UHFFFAOYSA-N. The full InChI is InChI=1S/2C6H7NP.2Sb/c2*7-5-3-1-2-4-6(5)8;;/h2*1-4,7H,8H2;;/q2*-1;2*+1.
What are the key properties of CID 86173784?
CID 86173784 has a molecular weight of 491.73 g/mol, XLogP of 1.36, 2 rotatable bonds, 2 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for CID 86173784 is sourced from PubChem (CID 86173784), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).