About di-n-pentylsiloxane
di-n-pentylsiloxane (PubChem CID 86173953) has the molecular formula C10H23OSi
and a molecular weight of 187.38 g/mol.
Molecular Properties
| Compound Name | di-n-pentylsiloxane |
| PubChem CID | 86173953 |
| Molecular Formula | C10H23OSi |
| Molecular Weight | 187.38 g/mol |
| Exact Mass | 187.15 |
| IUPAC Name | — |
| SMILES | CCCCC[Si](O)CCCCC |
| InChI | InChI=1S/C10H23OSi/c1-3-5-7-9-12(11)10-8-6-4-2/h11H,3-10H2,1-2H3 |
| InChIKey | XLAXKYXIPQDCSP-UHFFFAOYSA-N |
| XLogP | 3.35 |
| TPSA | 20.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 12 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 187.38 |
| LogP ≤ 5 | 3.35 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|
Analyze di-n-pentylsiloxane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of di-n-pentylsiloxane?
The IUPAC name of di-n-pentylsiloxane (CID 86173953) is not available.
What is the SMILES notation for di-n-pentylsiloxane?
The canonical SMILES for di-n-pentylsiloxane is CCCCC[Si](O)CCCCC.
What is the InChIKey of di-n-pentylsiloxane?
The InChIKey is XLAXKYXIPQDCSP-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H23OSi/c1-3-5-7-9-12(11)10-8-6-4-2/h11H,3-10H2,1-2H3.
What are the key properties of di-n-pentylsiloxane?
di-n-pentylsiloxane has a molecular weight of 187.38 g/mol, XLogP of 3.35, 8 rotatable bonds, 1 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for di-n-pentylsiloxane is sourced from PubChem (CID 86173953), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).