About 3-trimethylsilyl-4,5-dihydro-1H-pentalen-2-one
3-trimethylsilyl-4,5-dihydro-1H-pentalen-2-one (PubChem CID 86174744) has the molecular formula C11H16OSi
and a molecular weight of 192.33 g/mol. Its IUPAC name is 3-trimethylsilyl-4,5-dihydro-1H-pentalen-2-one.
Molecular Properties
| Compound Name | 3-trimethylsilyl-4,5-dihydro-1H-pentalen-2-one |
| PubChem CID | 86174744 |
| Molecular Formula | C11H16OSi |
| Molecular Weight | 192.33 g/mol |
| Exact Mass | 192.10 |
| IUPAC Name | 3-trimethylsilyl-4,5-dihydro-1H-pentalen-2-one |
| SMILES | C[Si](C)(C)C1=C2CCC=C2CC1=O |
| InChI | InChI=1S/C11H16OSi/c1-13(2,3)11-9-6-4-5-8(9)7-10(11)12/h5H,4,6-7H2,1-3H3 |
| InChIKey | IPEHLLONDVMMAU-UHFFFAOYSA-N |
| XLogP | 2.85 |
| TPSA | 17.07 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 192.33 |
| LogP ≤ 5 | 2.85 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|
Analyze 3-trimethylsilyl-4,5-dihydro-1H-pentalen-2-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-trimethylsilyl-4,5-dihydro-1H-pentalen-2-one?
The IUPAC name of 3-trimethylsilyl-4,5-dihydro-1H-pentalen-2-one (CID 86174744) is 3-trimethylsilyl-4,5-dihydro-1H-pentalen-2-one.
What is the SMILES notation for 3-trimethylsilyl-4,5-dihydro-1H-pentalen-2-one?
The canonical SMILES for 3-trimethylsilyl-4,5-dihydro-1H-pentalen-2-one is C[Si](C)(C)C1=C2CCC=C2CC1=O.
What is the InChIKey of 3-trimethylsilyl-4,5-dihydro-1H-pentalen-2-one?
The InChIKey is IPEHLLONDVMMAU-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H16OSi/c1-13(2,3)11-9-6-4-5-8(9)7-10(11)12/h5H,4,6-7H2,1-3H3.
What are the key properties of 3-trimethylsilyl-4,5-dihydro-1H-pentalen-2-one?
3-trimethylsilyl-4,5-dihydro-1H-pentalen-2-one has a molecular weight of 192.33 g/mol, XLogP of 2.85, 1 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 3-trimethylsilyl-4,5-dihydro-1H-pentalen-2-one is sourced from PubChem (CID 86174744), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).