About 6,6-diethoxyhexanoic acid
6,6-diethoxyhexanoic acid (PubChem CID 86175570) has the molecular formula C10H20O4
and a molecular weight of 204.27 g/mol. Its IUPAC name is 6,6-diethoxyhexanoic acid.
Molecular Properties
| Compound Name | 6,6-diethoxyhexanoic acid |
| PubChem CID | 86175570 |
| Molecular Formula | C10H20O4 |
| Molecular Weight | 204.27 g/mol |
| Exact Mass | 204.14 |
| IUPAC Name | 6,6-diethoxyhexanoic acid |
| SMILES | CCOC(CCCCC(=O)O)OCC |
| InChI | InChI=1S/C10H20O4/c1-3-13-10(14-4-2)8-6-5-7-9(11)12/h10H,3-8H2,1-2H3,(H,11,12) |
| InChIKey | MDPUQHLXHMKNGQ-UHFFFAOYSA-N |
| XLogP | 2.03 |
| TPSA | 55.76 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 204.27 |
| LogP ≤ 5 | 2.03 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|
Analyze 6,6-diethoxyhexanoic acid with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 6,6-diethoxyhexanoic acid?
The IUPAC name of 6,6-diethoxyhexanoic acid (CID 86175570) is 6,6-diethoxyhexanoic acid.
What is the SMILES notation for 6,6-diethoxyhexanoic acid?
The canonical SMILES for 6,6-diethoxyhexanoic acid is CCOC(CCCCC(=O)O)OCC.
What is the InChIKey of 6,6-diethoxyhexanoic acid?
The InChIKey is MDPUQHLXHMKNGQ-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H20O4/c1-3-13-10(14-4-2)8-6-5-7-9(11)12/h10H,3-8H2,1-2H3,(H,11,12).
What are the key properties of 6,6-diethoxyhexanoic acid?
6,6-diethoxyhexanoic acid has a molecular weight of 204.27 g/mol, XLogP of 2.03, 9 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 6,6-diethoxyhexanoic acid is sourced from PubChem (CID 86175570), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).