About 1-(3-hydroxy-1,2-oxazolidin-2-yl)ethanone
1-(3-hydroxy-1,2-oxazolidin-2-yl)ethanone (PubChem CID 86175976) has the molecular formula C5H9NO3
and a molecular weight of 131.13 g/mol. Its IUPAC name is 1-(3-hydroxy-1,2-oxazolidin-2-yl)ethanone.
Molecular Properties
| Compound Name | 1-(3-hydroxy-1,2-oxazolidin-2-yl)ethanone |
| PubChem CID | 86175976 |
| Molecular Formula | C5H9NO3 |
| Molecular Weight | 131.13 g/mol |
| Exact Mass | 131.06 |
| IUPAC Name | 1-(3-hydroxy-1,2-oxazolidin-2-yl)ethanone |
| SMILES | CC(=O)N1OCCC1O |
| InChI | InChI=1S/C5H9NO3/c1-4(7)6-5(8)2-3-9-6/h5,8H,2-3H2,1H3 |
| InChIKey | UJZCFWMNNVTOLA-UHFFFAOYSA-N |
| XLogP | -0.51 |
| TPSA | 49.77 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 9 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 131.13 |
| LogP ≤ 5 | -0.51 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 1-(3-hydroxy-1,2-oxazolidin-2-yl)ethanone with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-(3-hydroxy-1,2-oxazolidin-2-yl)ethanone?
The IUPAC name of 1-(3-hydroxy-1,2-oxazolidin-2-yl)ethanone (CID 86175976) is 1-(3-hydroxy-1,2-oxazolidin-2-yl)ethanone.
What is the SMILES notation for 1-(3-hydroxy-1,2-oxazolidin-2-yl)ethanone?
The canonical SMILES for 1-(3-hydroxy-1,2-oxazolidin-2-yl)ethanone is CC(=O)N1OCCC1O.
What is the InChIKey of 1-(3-hydroxy-1,2-oxazolidin-2-yl)ethanone?
The InChIKey is UJZCFWMNNVTOLA-UHFFFAOYSA-N. The full InChI is InChI=1S/C5H9NO3/c1-4(7)6-5(8)2-3-9-6/h5,8H,2-3H2,1H3.
What are the key properties of 1-(3-hydroxy-1,2-oxazolidin-2-yl)ethanone?
1-(3-hydroxy-1,2-oxazolidin-2-yl)ethanone has a molecular weight of 131.13 g/mol, XLogP of -0.51, 0 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 1-(3-hydroxy-1,2-oxazolidin-2-yl)ethanone is sourced from PubChem (CID 86175976), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).