C18H16N2O3 — CID 861762
(1R,2S,3S,4S)-3-(quinolin-5-ylcarbamoyl)bicyclo[2.2.1]hept-5-ene-2-carboxylic acid (PubChem CID 861762) has the molecular formula C18H16N2O3 and a molecular weight of 308.34 g/mol. Its IUPAC name is (1R,2S,3S,4S)-3-(quinolin-5-ylcarbamoyl)bicyclo[2.2.1]hept-5-ene-2-carboxylic acid.
| Compound Name | (1R,2S,3S,4S)-3-(quinolin-5-ylcarbamoyl)bicyclo[2.2.1]hept-5-ene-2-carboxylic acid |
|---|---|
| PubChem CID | 861762 |
| Molecular Formula | C18H16N2O3 |
| Molecular Weight | 308.34 g/mol |
| Exact Mass | 308.12 |
| IUPAC Name | (1R,2S,3S,4S)-3-(quinolin-5-ylcarbamoyl)bicyclo[2.2.1]hept-5-ene-2-carboxylic acid |
| SMILES | O=C(Nc1cccc2ncccc12)[C@@H]1[C@@H](C(=O)O)[C@H]2C=C[C@@H]1C2 |
| InChI | InChI=1S/C18H16N2O3/c21-17(15-10-6-7-11(9-10)16(15)18(22)23)20-14-5-1-4-13-12(14)3-2-8-19-13/h1-8,10-11,15-16H,9H2,(H,20,21)(H,22,23)/t10-,11+,15+,16+/m1/s1 |
| InChIKey | UIFCFMBQXBIEAS-OVTCNUJSSA-N |
| XLogP | 2.70 |
| TPSA | 79.29 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 308.34 |
| LogP ≤ 5 | 2.70 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|