C9H12O4 — CID 86176939
3-[2-(1,3-dioxolan-2-yl)ethyl]-2H-furan-5-one (PubChem CID 86176939) has the molecular formula C9H12O4 and a molecular weight of 184.19 g/mol. Its IUPAC name is 3-[2-(1,3-dioxolan-2-yl)ethyl]-2H-furan-5-one.
| Compound Name | 3-[2-(1,3-dioxolan-2-yl)ethyl]-2H-furan-5-one |
|---|---|
| PubChem CID | 86176939 |
| Molecular Formula | C9H12O4 |
| Molecular Weight | 184.19 g/mol |
| Exact Mass | 184.07 |
| IUPAC Name | 3-[2-(1,3-dioxolan-2-yl)ethyl]-2H-furan-5-one |
| SMILES | O=C1C=C(CCC2OCCO2)CO1 |
| InChI | InChI=1S/C9H12O4/c10-8-5-7(6-13-8)1-2-9-11-3-4-12-9/h5,9H,1-4,6H2 |
| InChIKey | RECRARJQVMGCFQ-UHFFFAOYSA-N |
| XLogP | 0.62 |
| TPSA | 44.76 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 184.19 |
| LogP ≤ 5 | 0.62 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |