About 2-amino-N-(5-amino-1-phenyl-9H-pyrido[3,4-b]indol-6-yl)benzamide
2-amino-N-(5-amino-1-phenyl-9H-pyrido[3,4-b]indol-6-yl)benzamide (PubChem CID 86177233) has the molecular formula C24H19N5O
and a molecular weight of 393.45 g/mol. Its IUPAC name is 2-amino-N-(5-amino-1-phenyl-9H-pyrido[3,4-b]indol-6-yl)benzamide.
Molecular Properties
| Compound Name | 2-amino-N-(5-amino-1-phenyl-9H-pyrido[3,4-b]indol-6-yl)benzamide |
| PubChem CID | 86177233 |
| Molecular Formula | C24H19N5O |
| Molecular Weight | 393.45 g/mol |
| Exact Mass | 393.16 |
| IUPAC Name | 2-amino-N-(5-amino-1-phenyl-9H-pyrido[3,4-b]indol-6-yl)benzamide |
| SMILES | Nc1ccccc1C(=O)Nc1ccc2[nH]c3c(-c4ccccc4)nccc3c2c1N |
| InChI | InChI=1S/C24H19N5O/c25-17-9-5-4-8-15(17)24(30)29-19-11-10-18-20(21(19)26)16-12-13-27-22(23(16)28-18)14-6-2-1-3-7-14/h1-13,28H,25-26H2,(H,29,30) |
| InChIKey | URJFPCMTCBCHFF-UHFFFAOYSA-N |
| XLogP | 4.80 |
| TPSA | 109.82 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 30 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 393.45 |
| LogP ≤ 5 | 4.80 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|
Analyze 2-amino-N-(5-amino-1-phenyl-9H-pyrido[3,4-b]indol-6-yl)benzamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-amino-N-(5-amino-1-phenyl-9H-pyrido[3,4-b]indol-6-yl)benzamide?
The IUPAC name of 2-amino-N-(5-amino-1-phenyl-9H-pyrido[3,4-b]indol-6-yl)benzamide (CID 86177233) is 2-amino-N-(5-amino-1-phenyl-9H-pyrido[3,4-b]indol-6-yl)benzamide.
What is the SMILES notation for 2-amino-N-(5-amino-1-phenyl-9H-pyrido[3,4-b]indol-6-yl)benzamide?
The canonical SMILES for 2-amino-N-(5-amino-1-phenyl-9H-pyrido[3,4-b]indol-6-yl)benzamide is Nc1ccccc1C(=O)Nc1ccc2[nH]c3c(-c4ccccc4)nccc3c2c1N.
What is the InChIKey of 2-amino-N-(5-amino-1-phenyl-9H-pyrido[3,4-b]indol-6-yl)benzamide?
The InChIKey is URJFPCMTCBCHFF-UHFFFAOYSA-N. The full InChI is InChI=1S/C24H19N5O/c25-17-9-5-4-8-15(17)24(30)29-19-11-10-18-20(21(19)26)16-12-13-27-22(23(16)28-18)14-6-2-1-3-7-14/h1-13,28H,25-26H2,(H,29,30).
What are the key properties of 2-amino-N-(5-amino-1-phenyl-9H-pyrido[3,4-b]indol-6-yl)benzamide?
2-amino-N-(5-amino-1-phenyl-9H-pyrido[3,4-b]indol-6-yl)benzamide has a molecular weight of 393.45 g/mol, XLogP of 4.80, 3 rotatable bonds, 4 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 2-amino-N-(5-amino-1-phenyl-9H-pyrido[3,4-b]indol-6-yl)benzamide is sourced from PubChem (CID 86177233), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).