About 4-tert-butyl-5,5-dimethylhexa-1,3-diene
4-tert-butyl-5,5-dimethylhexa-1,3-diene (PubChem CID 86177250) has the molecular formula C12H22
and a molecular weight of 166.31 g/mol. Its IUPAC name is 4-tert-butyl-5,5-dimethylhexa-1,3-diene.
Molecular Properties
| Compound Name | 4-tert-butyl-5,5-dimethylhexa-1,3-diene |
| PubChem CID | 86177250 |
| Molecular Formula | C12H22 |
| Molecular Weight | 166.31 g/mol |
| Exact Mass | 166.17 |
| IUPAC Name | 4-tert-butyl-5,5-dimethylhexa-1,3-diene |
| SMILES | C=CC=C(C(C)(C)C)C(C)(C)C |
| InChI | InChI=1S/C12H22/c1-8-9-10(11(2,3)4)12(5,6)7/h8-9H,1H2,2-7H3 |
| InChIKey | XTIHZCFWIDIKHZ-UHFFFAOYSA-N |
| XLogP | 4.19 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 1 |
| Heavy Atoms | 12 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 166.31 |
| LogP ≤ 5 | 4.19 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|
Analyze 4-tert-butyl-5,5-dimethylhexa-1,3-diene with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-tert-butyl-5,5-dimethylhexa-1,3-diene?
The IUPAC name of 4-tert-butyl-5,5-dimethylhexa-1,3-diene (CID 86177250) is 4-tert-butyl-5,5-dimethylhexa-1,3-diene.
What is the SMILES notation for 4-tert-butyl-5,5-dimethylhexa-1,3-diene?
The canonical SMILES for 4-tert-butyl-5,5-dimethylhexa-1,3-diene is C=CC=C(C(C)(C)C)C(C)(C)C.
What is the InChIKey of 4-tert-butyl-5,5-dimethylhexa-1,3-diene?
The InChIKey is XTIHZCFWIDIKHZ-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H22/c1-8-9-10(11(2,3)4)12(5,6)7/h8-9H,1H2,2-7H3.
What are the key properties of 4-tert-butyl-5,5-dimethylhexa-1,3-diene?
4-tert-butyl-5,5-dimethylhexa-1,3-diene has a molecular weight of 166.31 g/mol, XLogP of 4.19, 1 rotatable bonds, 0 hydrogen bond donors, and 0 hydrogen bond acceptors.
Where does this data come from?
All data for 4-tert-butyl-5,5-dimethylhexa-1,3-diene is sourced from PubChem (CID 86177250), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).