About 3-methyl-6-(1,2,2-trimethylcyclopentyl)pyridazine
3-methyl-6-(1,2,2-trimethylcyclopentyl)pyridazine (PubChem CID 86178150) has the molecular formula C13H20N2
and a molecular weight of 204.32 g/mol. Its IUPAC name is 3-methyl-6-(1,2,2-trimethylcyclopentyl)pyridazine.
Molecular Properties
| Compound Name | 3-methyl-6-(1,2,2-trimethylcyclopentyl)pyridazine |
| PubChem CID | 86178150 |
| Molecular Formula | C13H20N2 |
| Molecular Weight | 204.32 g/mol |
| Exact Mass | 204.16 |
| IUPAC Name | 3-methyl-6-(1,2,2-trimethylcyclopentyl)pyridazine |
| SMILES | Cc1ccc(C2(C)CCCC2(C)C)nn1 |
| InChI | InChI=1S/C13H20N2/c1-10-6-7-11(15-14-10)13(4)9-5-8-12(13,2)3/h6-7H,5,8-9H2,1-4H3 |
| InChIKey | DFJQJVPEUIVLSQ-UHFFFAOYSA-N |
| XLogP | 3.25 |
| TPSA | 25.78 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 204.32 |
| LogP ≤ 5 | 3.25 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze 3-methyl-6-(1,2,2-trimethylcyclopentyl)pyridazine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-methyl-6-(1,2,2-trimethylcyclopentyl)pyridazine?
The IUPAC name of 3-methyl-6-(1,2,2-trimethylcyclopentyl)pyridazine (CID 86178150) is 3-methyl-6-(1,2,2-trimethylcyclopentyl)pyridazine.
What is the SMILES notation for 3-methyl-6-(1,2,2-trimethylcyclopentyl)pyridazine?
The canonical SMILES for 3-methyl-6-(1,2,2-trimethylcyclopentyl)pyridazine is Cc1ccc(C2(C)CCCC2(C)C)nn1.
What is the InChIKey of 3-methyl-6-(1,2,2-trimethylcyclopentyl)pyridazine?
The InChIKey is DFJQJVPEUIVLSQ-UHFFFAOYSA-N. The full InChI is InChI=1S/C13H20N2/c1-10-6-7-11(15-14-10)13(4)9-5-8-12(13,2)3/h6-7H,5,8-9H2,1-4H3.
What are the key properties of 3-methyl-6-(1,2,2-trimethylcyclopentyl)pyridazine?
3-methyl-6-(1,2,2-trimethylcyclopentyl)pyridazine has a molecular weight of 204.32 g/mol, XLogP of 3.25, 1 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 3-methyl-6-(1,2,2-trimethylcyclopentyl)pyridazine is sourced from PubChem (CID 86178150), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).