C8H5F13O — CID 86179549
4,4,5,5,6,6,6-heptafluoro-3,3-bis(trifluoromethyl)hexan-1-ol (PubChem CID 86179549) has the molecular formula C8H5F13O and a molecular weight of 364.10 g/mol. Its IUPAC name is 4,4,5,5,6,6,6-heptafluoro-3,3-bis(trifluoromethyl)hexan-1-ol.
| Compound Name | 4,4,5,5,6,6,6-heptafluoro-3,3-bis(trifluoromethyl)hexan-1-ol |
|---|---|
| PubChem CID | 86179549 |
| Molecular Formula | C8H5F13O |
| Molecular Weight | 364.10 g/mol |
| Exact Mass | 364.01 |
| IUPAC Name | 4,4,5,5,6,6,6-heptafluoro-3,3-bis(trifluoromethyl)hexan-1-ol |
| SMILES | OCCC(C(F)(F)F)(C(F)(F)F)C(F)(F)C(F)(F)C(F)(F)F |
| InChI | InChI=1S/C8H5F13O/c9-4(10,5(11,12)8(19,20)21)3(1-2-22,6(13,14)15)7(16,17)18/h22H,1-2H2 |
| InChIKey | XAQNBISBMQVMFT-UHFFFAOYSA-N |
| XLogP | 4.31 |
| TPSA | 20.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 364.10 |
| LogP ≤ 5 | 4.31 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|