About 4-bromo-3,4-dihydro-2H-oxepin-7-one
4-bromo-3,4-dihydro-2H-oxepin-7-one (PubChem CID 86179692) has the molecular formula C6H7BrO2
and a molecular weight of 191.02 g/mol. Its IUPAC name is 4-bromo-3,4-dihydro-2H-oxepin-7-one.
Molecular Properties
| Compound Name | 4-bromo-3,4-dihydro-2H-oxepin-7-one |
| PubChem CID | 86179692 |
| Molecular Formula | C6H7BrO2 |
| Molecular Weight | 191.02 g/mol |
| Exact Mass | 189.96 |
| IUPAC Name | 4-bromo-3,4-dihydro-2H-oxepin-7-one |
| SMILES | O=C1C=CC(Br)CCO1 |
| InChI | InChI=1S/C6H7BrO2/c7-5-1-2-6(8)9-4-3-5/h1-2,5H,3-4H2 |
| InChIKey | RCSGAYDBEXZGOC-UHFFFAOYSA-N |
| XLogP | 1.25 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 9 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 191.02 |
| LogP ≤ 5 | 1.25 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|
Analyze 4-bromo-3,4-dihydro-2H-oxepin-7-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-bromo-3,4-dihydro-2H-oxepin-7-one?
The IUPAC name of 4-bromo-3,4-dihydro-2H-oxepin-7-one (CID 86179692) is 4-bromo-3,4-dihydro-2H-oxepin-7-one.
What is the SMILES notation for 4-bromo-3,4-dihydro-2H-oxepin-7-one?
The canonical SMILES for 4-bromo-3,4-dihydro-2H-oxepin-7-one is O=C1C=CC(Br)CCO1.
What is the InChIKey of 4-bromo-3,4-dihydro-2H-oxepin-7-one?
The InChIKey is RCSGAYDBEXZGOC-UHFFFAOYSA-N. The full InChI is InChI=1S/C6H7BrO2/c7-5-1-2-6(8)9-4-3-5/h1-2,5H,3-4H2.
What are the key properties of 4-bromo-3,4-dihydro-2H-oxepin-7-one?
4-bromo-3,4-dihydro-2H-oxepin-7-one has a molecular weight of 191.02 g/mol, XLogP of 1.25, 0 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 4-bromo-3,4-dihydro-2H-oxepin-7-one is sourced from PubChem (CID 86179692), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).