About 2-imino-1,4,6-trimethylpyrimidine-5-carbonitrile
2-imino-1,4,6-trimethylpyrimidine-5-carbonitrile (PubChem CID 86181023) has the molecular formula C8H10N4
and a molecular weight of 162.20 g/mol. Its IUPAC name is 2-imino-1,4,6-trimethylpyrimidine-5-carbonitrile.
Molecular Properties
| Compound Name | 2-imino-1,4,6-trimethylpyrimidine-5-carbonitrile |
| PubChem CID | 86181023 |
| Molecular Formula | C8H10N4 |
| Molecular Weight | 162.20 g/mol |
| Exact Mass | 162.09 |
| IUPAC Name | 2-imino-1,4,6-trimethylpyrimidine-5-carbonitrile |
| SMILES | [H]/N=c1\nc(C)c(C#N)c(C)n1C |
| InChI | InChI=1S/C8H10N4/c1-5-7(4-9)6(2)12(3)8(10)11-5/h10H,1-3H3/b10-8+ |
| InChIKey | OUNJLZKYRUBOJX-CSKARUKUSA-N |
| XLogP | 0.39 |
| TPSA | 65.46 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | |
| Heavy Atoms | 12 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 162.20 |
| LogP ≤ 5 | 0.39 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze 2-imino-1,4,6-trimethylpyrimidine-5-carbonitrile with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-imino-1,4,6-trimethylpyrimidine-5-carbonitrile?
The IUPAC name of 2-imino-1,4,6-trimethylpyrimidine-5-carbonitrile (CID 86181023) is 2-imino-1,4,6-trimethylpyrimidine-5-carbonitrile.
What is the SMILES notation for 2-imino-1,4,6-trimethylpyrimidine-5-carbonitrile?
The canonical SMILES for 2-imino-1,4,6-trimethylpyrimidine-5-carbonitrile is [H]/N=c1\nc(C)c(C#N)c(C)n1C.
What is the InChIKey of 2-imino-1,4,6-trimethylpyrimidine-5-carbonitrile?
The InChIKey is OUNJLZKYRUBOJX-CSKARUKUSA-N. The full InChI is InChI=1S/C8H10N4/c1-5-7(4-9)6(2)12(3)8(10)11-5/h10H,1-3H3/b10-8+.
What are the key properties of 2-imino-1,4,6-trimethylpyrimidine-5-carbonitrile?
2-imino-1,4,6-trimethylpyrimidine-5-carbonitrile has a molecular weight of 162.20 g/mol, XLogP of 0.39, 0 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 2-imino-1,4,6-trimethylpyrimidine-5-carbonitrile is sourced from PubChem (CID 86181023), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).