C5H4F5N3S — CID 86181492
4-methyl-3-(1,1,2,2,2-pentafluoroethyl)-1H-1,2,4-triazole-5-thione (PubChem CID 86181492) has the molecular formula C5H4F5N3S and a molecular weight of 233.17 g/mol. Its IUPAC name is 4-methyl-3-(1,1,2,2,2-pentafluoroethyl)-1H-1,2,4-triazole-5-thione.
| Compound Name | 4-methyl-3-(1,1,2,2,2-pentafluoroethyl)-1H-1,2,4-triazole-5-thione |
|---|---|
| PubChem CID | 86181492 |
| Molecular Formula | C5H4F5N3S |
| Molecular Weight | 233.17 g/mol |
| Exact Mass | 233.00 |
| IUPAC Name | 4-methyl-3-(1,1,2,2,2-pentafluoroethyl)-1H-1,2,4-triazole-5-thione |
| SMILES | Cn1c(C(F)(F)C(F)(F)F)n[nH]c1=S |
| InChI | InChI=1S/C5H4F5N3S/c1-13-2(11-12-3(13)14)4(6,7)5(8,9)10/h1H3,(H,12,14) |
| InChIKey | ALALEWMXFUIZCR-UHFFFAOYSA-N |
| XLogP | 2.13 |
| TPSA | 33.61 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 233.17 |
| LogP ≤ 5 | 2.13 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|