C15H16N2O3 — CID 86181946
2-(4-hydroxyphenyl)-N'-(4-methoxyphenyl)acetohydrazide (PubChem CID 86181946) has the molecular formula C15H16N2O3 and a molecular weight of 272.30 g/mol. Its IUPAC name is 2-(4-hydroxyphenyl)-N'-(4-methoxyphenyl)acetohydrazide.
| Compound Name | 2-(4-hydroxyphenyl)-N'-(4-methoxyphenyl)acetohydrazide |
|---|---|
| PubChem CID | 86181946 |
| Molecular Formula | C15H16N2O3 |
| Molecular Weight | 272.30 g/mol |
| Exact Mass | 272.12 |
| IUPAC Name | 2-(4-hydroxyphenyl)-N'-(4-methoxyphenyl)acetohydrazide |
| SMILES | COc1ccc(NNC(=O)Cc2ccc(O)cc2)cc1 |
| InChI | InChI=1S/C15H16N2O3/c1-20-14-8-4-12(5-9-14)16-17-15(19)10-11-2-6-13(18)7-3-11/h2-9,16,18H,10H2,1H3,(H,17,19) |
| InChIKey | WLVBWBXHWBJZKS-UHFFFAOYSA-N |
| XLogP | 2.09 |
| TPSA | 70.59 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 272.30 |
| LogP ≤ 5 | 2.09 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|