C29H12B2F20Si — CID 86182021
1,2-bis[bis(2,3,4,5,6-pentafluorophenyl)boranyl]ethyl-trimethylsilane (PubChem CID 86182021) has the molecular formula C29H12B2F20Si and a molecular weight of 790.08 g/mol. Its IUPAC name is 1,2-bis[bis(2,3,4,5,6-pentafluorophenyl)boranyl]ethyl-trimethylsilane.
| Compound Name | 1,2-bis[bis(2,3,4,5,6-pentafluorophenyl)boranyl]ethyl-trimethylsilane |
|---|---|
| PubChem CID | 86182021 |
| Molecular Formula | C29H12B2F20Si |
| Molecular Weight | 790.08 g/mol |
| Exact Mass | 790.06 |
| IUPAC Name | 1,2-bis[bis(2,3,4,5,6-pentafluorophenyl)boranyl]ethyl-trimethylsilane |
| SMILES | C[Si](C)(C)C(CB(c1c(F)c(F)c(F)c(F)c1F)c1c(F)c(F)c(F)c(F)c1F)B(c1c(F)c(F)c(F)c(F)c1F)c1c(F)c(F)c(F)c(F)c1F |
| InChI | InChI=1S/C29H12B2F20Si/c1-52(2,3)5(31(8-14(36)22(44)28(50)23(45)15(8)37)9-16(38)24(46)29(51)25(47)17(9)39)4-30(6-10(32)18(40)26(48)19(41)11(6)33)7-12(34)20(42)27(49)21(43)13(7)35/h5H,4H2,1-3H3 |
| InChIKey | AHXYTGFYYZLSRJ-UHFFFAOYSA-N |
| XLogP | 7.63 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 8 |
| Heavy Atoms | 52 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 790.08 |
| LogP ≤ 5 | 7.63 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'}, {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|