About 2-pentoxyterephthalic acid
2-pentoxyterephthalic acid (PubChem CID 86182031) has the molecular formula C13H16O5
and a molecular weight of 252.27 g/mol. Its IUPAC name is 2-pentoxyterephthalic acid.
Molecular Properties
| Compound Name | 2-pentoxyterephthalic acid |
| PubChem CID | 86182031 |
| Molecular Formula | C13H16O5 |
| Molecular Weight | 252.27 g/mol |
| Exact Mass | 252.10 |
| IUPAC Name | 2-pentoxyterephthalic acid |
| SMILES | CCCCCOc1cc(C(=O)O)ccc1C(=O)O |
| InChI | InChI=1S/C13H16O5/c1-2-3-4-7-18-11-8-9(12(14)15)5-6-10(11)13(16)17/h5-6,8H,2-4,7H2,1H3,(H,14,15)(H,16,17) |
| InChIKey | BXJVJYNRWRCQKA-UHFFFAOYSA-N |
| XLogP | 2.65 |
| TPSA | 83.83 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 18 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 252.27 |
| LogP ≤ 5 | 2.65 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|
Analyze 2-pentoxyterephthalic acid with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-pentoxyterephthalic acid?
The IUPAC name of 2-pentoxyterephthalic acid (CID 86182031) is 2-pentoxyterephthalic acid.
What is the SMILES notation for 2-pentoxyterephthalic acid?
The canonical SMILES for 2-pentoxyterephthalic acid is CCCCCOc1cc(C(=O)O)ccc1C(=O)O.
What is the InChIKey of 2-pentoxyterephthalic acid?
The InChIKey is BXJVJYNRWRCQKA-UHFFFAOYSA-N. The full InChI is InChI=1S/C13H16O5/c1-2-3-4-7-18-11-8-9(12(14)15)5-6-10(11)13(16)17/h5-6,8H,2-4,7H2,1H3,(H,14,15)(H,16,17).
What are the key properties of 2-pentoxyterephthalic acid?
2-pentoxyterephthalic acid has a molecular weight of 252.27 g/mol, XLogP of 2.65, 7 rotatable bonds, 2 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 2-pentoxyterephthalic acid is sourced from PubChem (CID 86182031), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).